A2259312
Cinnamamide, Predominantly trans , 97%,predominantlytrans , 621-79-4
CAS NO.:621-79-4
Empirical Formula: C9H9NO
Molecular Weight: 147.17
MDL number: MFCD00008033
EINECS: 210-707-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB241.60 | In Stock |
|
| 500g | RMB913.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C(lit.) |
| Boiling point: | 267.28°C (rough estimate) |
| Density | 1.1135 (rough estimate) |
| refractive index | 1.5450 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 15+-.0.50(Predicted) |
| form | Crystalline Powder |
| color | Off-white to beige |
| BRN | 2040577 |
| InChI | 1S/C9H9NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H2,10,11)/b7-6+ |
| InChIKey | APEJMQOBVMLION-VOTSOKGWSA-N |
| SMILES | [H]\C(=C(\[H])c1ccccc1)C(N)=O |
| CAS DataBase Reference | 621-79-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzylidene acetamide(621-79-4) |
| EPA Substance Registry System | 2-Propenamide, 3-phenyl- (621-79-4) |
Description and Uses
Cinnamamide, a non-lethal repellent, deters feeding by a wide range of avian species.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | GD6853000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |



