A2261912
1-Chloro-4-iodobenzene , 99% , 637-87-6
CAS NO.:637-87-6
Empirical Formula: C6H4ClI
Molecular Weight: 238.45
MDL number: MFCD00001053
EINECS: 211-305-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB100.80 | In Stock |
|
| 500G | RMB478.40 | In Stock |
|
| 1kg | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-54 °C(lit.) |
| Boiling point: | 226-227 °C(lit.) |
| Density | 1.8860 |
| Flash point: | 227 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Crystalline Powder or Crystals |
| color | Off-white to light beige |
| Sensitive | Light Sensitive |
| BRN | 1634414 |
| InChI | InChI=1S/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChIKey | GWQSENYKCGJTRI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(I)C=C1 |
| CAS DataBase Reference | 637-87-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-iodo-(637-87-6) |
| EPA Substance Registry System | Benzene, 1-chloro-4-iodo- (637-87-6) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |




