A2263112
1,1-Cyclobutanedicarboxylic acid , 99% , 5445-51-2
CAS NO.:5445-51-2
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD00001325
EINECS: 226-651-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB106.40 | In Stock |
|
| 100G | RMB323.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158 °C(lit.) |
| Boiling point: | 222.71°C (rough estimate) |
| Density | 1.3217 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | pK1:3.13 ;pK2:5.88 (25°C) |
| form | Fine Crystalline Powder |
| color | White |
| BRN | 2046031 |
| InChI | InChI=1S/C6H8O4/c7-4(8)6(5(9)10)2-1-3-6/h1-3H2,(H,7,8)(H,9,10) |
| InChIKey | CCQPAEQGAVNNIA-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)(C(O)=O)CCC1 |
| CAS DataBase Reference | 5445-51-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1-Cyclobutanedicarboxylic acid(5445-51-2) |
| EPA Substance Registry System | 1,1-Cyclobutanedicarboxylic acid (5445-51-2) |
Description and Uses
Cyclobutane-1,1-dicarboxylic acid can be used as:
- A reactant to synthesize lithium coordination polymer by treating with lithium carbonate.
- A ligand to prepare various lanthanide metal-organic frameworks (LnMOFs) via a solvothermal method. Eu+3 based MOF is applicable as a selective chemical sensor for detecting CH3OH due to its high luminescence quantum yield.
It can also be used as a starting material in the synthesis of carboplatin (cis-diammine(1,1-cyclobutanedicarboxyl-ate)platinum(II)).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-28A |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | GU1335000 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29172000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






