A2266012
Cimetidine , 99% , 51481-61-9
Synonym(s):
SKF-92334
CAS NO.:51481-61-9
Empirical Formula: C10H16N6S
Molecular Weight: 252.34
MDL number: MFCD00133296
EINECS: 257-232-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB60.00 | In Stock |
|
| 5G | RMB251.20 | In Stock |
|
| 25G | RMB613.60 | In Stock |
|
| 500g | RMB799.20 | In Stock |
|
| 100g | RMB1532.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-144°C |
| Boiling point: | 476.2±55.0 °C(Predicted) |
| Density | 1.2583 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 2-8°C |
| solubility | Slightly soluble in water, soluble in ethanol (96 per cent), practically insoluble in methylene chloride. It dissolves in dilute mineral acids. |
| form | Solid |
| pka | pKa 6.80 (Uncertain) |
| color | White to Off-White |
| Water Solubility | 0.5 g/100 mL at 20 ºC |
| Merck | 14,2279 |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | 1S/C10H16N6S/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14) |
| InChIKey | AQIXAKUUQRKLND-UHFFFAOYSA-N |
| SMILES | CN\C(NC#N)=N\CCSCc1nc[nH]c1C |
| CAS DataBase Reference | 51481-61-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Cimetidine(51481-61-9) |
| IARC | 3 (Vol. 50) 1990 |
| EPA Substance Registry System | Guanidine, N-cyano-N'-methyl-N''-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]- (51481-61-9) |
Description and Uses
Cimetidine is a representative of first-generation antihistamine drugs that block H2 receptors.
antibacterial
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H303-H360 |
| Precautionary statements | P202-P405-P501a-P201-P280-P308+P313 |
| Hazard Codes | T,Xn |
| Risk Statements | 60-42/43-36/37/38-20/22 |
| Safety Statements | 53-26-36/37/39-45-36-22 |
| WGK Germany | 3 |
| RTECS | MF0035500 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 51481-61-9(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): 2600, 5000 orally; 150, 106 i.v.; 470, 650 i.p. (Brimblecombe) |




![1-Cyano-2-methyl-1-[2-(5-methylimidazol-4-yl-methylthio)ethyl]isothiourea](https://img.chemicalbook.com/CAS/GIF/52378-40-2.gif)


