A2266212
2-Chloro-6-fluorobenzonitrile , 98% , 668-45-1
CAS NO.:668-45-1
Empirical Formula: C7H3ClFN
Molecular Weight: 155.56
MDL number: MFCD00001780
EINECS: 211-571-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 10g | RMB55.20 | In Stock |
|
| 25G | RMB88.80 | In Stock |
|
| 50g | RMB159.20 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 500g | RMB1463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C(lit.) |
| Boiling point: | 104 °C11 mm Hg(lit.) |
| Density | 1.3760 (estimate) |
| Flash point: | 104-105°C/11mm |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1940332 |
| InChI | InChI=1S/C7H3ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(F)C=CC=C1Cl |
| CAS DataBase Reference | 668-45-1(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-fluorobenzonitrile was used in the synthesis of:
- rac-2-chloro-6-(oxiran-2-ylmethoxy)benzonitrile
- high-molecular-weight, soluble polyarylether alternating copolymers containing pendent cyano groups
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H302-H311-H332-H301+H311+H331 |
| Precautionary statements | P280h-P309-P310-P264-P270-P271-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




