A2267112
Cytochalasin H from Phomopsis sp , 85% , 53760-19-3
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB559.20 | In Stock |
|
| 5MG | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252-258 °C |
| Boiling point: | 587°C (rough estimate) |
| Density | 1.1369 (rough estimate) |
| refractive index | 1.6310 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: 10 mg/mL, clear, colorless |
| pka | 13.88±0.70(Predicted) |
| form | A lyophilisate |
| color | Long needles from CHCl3/Et2O |
| BRN | 1632647 |
| InChIKey | NAEWXXDGBKTIMN-QHDZSFFESA-N |
| SMILES | [C@H]1(CC2=CC=CC=C2)[C@@]2([H])[C@@]3([C@H](OC(C)=O)C=C[C@@](O)(C)C[C@@H](C)CC=C[C@@]3([H])[C@H](O)C(=C)[C@H]2C)C(=O)N1 |t:17,26| |
| LogP | 4.758 (est) |
Description and Uses
Cytochalasin H is one of a family of potent mycotoxins produced by a range of fungi. All members of the class exhibit profound effects on cytoskeletal proteins, resulting in pronounced morphogenic changes in animals and plants. In vitro, cytochalasin H exhibits antibacterial, antifungal, nematocidal and antitumour activity.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H361 |
| Precautionary statements | P201-P202-P260-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28-63 |
| Safety Statements | 28-36/37-45 |
| RIDADR | UN 3462 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HA5306000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Toxicity | cyt-hmn:lym 50 mg/L IJEBA6 16,430,78 |
