A2268012
(+)-10,2-Camphorsultam , 97% , 108448-77-7
Synonym(s):
(+)-10,2-Camphorsultam;(+)-exo-10,2-Bornanesultam;(1R,5S)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide;L -2,10-Camphorsultam
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB291.20 | In Stock |
|
| 100G | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-187 °C(lit.) |
| alpha | 33 º (c=4.9, CHCl3) |
| Boiling point: | 324.8±25.0 °C(Predicted) |
| Density | 1.1469 (rough estimate) |
| refractive index | 31 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Chloroform |
| form | powder to crystal |
| pka | 11.05±0.40(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +32°, c = 5 in chloroform |
| BRN | 4675755 |
| InChI | InChI=1S/C10H17NO2S/c1-9(2)7-3-4-10(9)6-14(12,13)11-8(10)5-7/h7-8,11H,3-6H2,1-2H3/t7-,8-,10-/m0/s1 |
| InChIKey | DPJYJNYYDJOJNO-CFGJQEBVSA-N |
| SMILES | N1[C@]2([H])[C@@]3(C(C)(C)[C@]([H])(C2)CC3)CS1(=O)=O |
| CAS DataBase Reference | 108448-77-7(CAS DataBase Reference) |
Description and Uses
(1R)-(+)-2,10-Camphorsultam has been used as a reactant in the synthesis of pyrrolidine acid analogs as potent dual PPARα/γ agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





