A2272212
Chlorobutanol , 98% , 6001-64-5
Synonym(s):
MET;Chlorobutanol;Chloretone;Hepatocyte growth factor receptor;HGF/SF receptor
CAS NO.:6001-64-5
Empirical Formula: C8H16Cl6O3
Molecular Weight: 372.93
MDL number: MFCD02179352
EINECS: 611-927-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB40.80 | In Stock |
|
| 100G | RMB134.40 | In Stock |
|
| 500G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79 °C(lit.) |
| Boiling point: | 173-175 °C |
| Flash point: | 100 °C |
| storage temp. | 2-8°C |
| solubility | Slightly soluble in water, very soluble in ethanol (96 per cent), soluble in glycerol (85 per cent). |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to almost white |
| PH | 4.5-6 (20°C, 7.7g/L in H2O) |
| biological source | mouse |
| Water Solubility | Soluble in ethanol, ether, chloroform, and glycerol. Insoluble in water. |
| Merck | 14,2129 |
| BRN | 878167 |
| Stability: | Stable. Generates toxic fumes on combustion. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/2C4H7Cl3O.H2O/c2*1-3(2,8)4(5,6)7;/h2*8H,1-2H3;1H2 |
| InChIKey | WRWLCXJYIMRJIN-UHFFFAOYSA-N |
| SMILES | O.CC(C)(O)C(Cl)(Cl)Cl.CC(C)(O)C(Cl)(Cl)Cl |
| LogP | 2.074 (est) |
| CAS DataBase Reference | 6001-64-5 |
Description and Uses
1,1,1-Trichloro-2-methyl-2-propanol hemihydrate in combination with dimethyl sulfone, can serve as an appropriate solvent for the freeze drying of certain parenteral organic drugs, which have an increase in many factors such as stability, dissolution rate, dosing accuracy and sterility.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | UC0175000 |
| TSCA | Yes |
| HS Code | 29055900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




