A2274312
3-Cyanophenylboronic acid , 98% , 150255-96-2
Synonym(s):
(m-Cyanophenyl)boronic acid;3-Cyanobenzeneboronic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB364.80 | In Stock |
|
| 100G | RMB648.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 298 °C (dec.) (lit.) |
| Boiling point: | 347.4±44.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 7.17±0.10(Predicted) |
| form | solid |
| color | White to Light yellow |
| BRN | 6136720 |
| InChI | InChI=1S/C7H6BNO2/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,10-11H |
| InChIKey | XDBHWPLGGBLUHH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(C#N)=C1)(O)O |
| CAS DataBase Reference | 150255-96-2(CAS DataBase Reference) |
Description and Uses
3-Cyanophenylboronic acid can be used:
- As an intermediate in the synthesis of piperidine-based MCH R1 antagonists.
- As a substrate in the Suzuki coupling reactions to prepare 4-aryl-1,8-naphthyridin-2(1H)-ones.
- As an intermediate in the synthesis of biaryl-based?phenylalanine?amino acid analogs, which are used as kainate receptors ligands.
- To prepare phenylimidazole-based?Ir(III) complexes for phosphorescent blue OLED applications.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C,Xn |
| Risk Statements | 36/37/38-34-36-41-37/38-22 |
| Safety Statements | 26-37/39-45-36/37/39-22-39-36 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





