A2275112
3-Chlorophenylboronic acid , 97% , 63503-60-6
Synonym(s):
(m-Chlorophenyl)boronic acid;m-Chlorobenzeneboronic acid;3-Chlorobenzeneboronic acid
CAS NO.:63503-60-6
Empirical Formula: C6H6BClO2
Molecular Weight: 156.37
MDL number: MFCD00161354
EINECS: 628-786-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB167.20 | In Stock |
|
| 100g | RMB592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-189 °C(lit.) |
| Boiling point: | 311.4±44.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 7.55±0.10(Predicted) |
| form | Crystalline Powder or Needles |
| color | White to light yellow-green |
| Water Solubility | Slightly soluble in water. soluble in ether, tetrahydrofuran,, dimethyl sulfoxide, dimethyl formamide, methanol. |
| BRN | 2936343 |
| InChI | InChI=1S/C6H6BClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H |
| InChIKey | SDEAGACSNFSZCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(Cl)=C1)(O)O |
| CAS DataBase Reference | 63503-60-6(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |





