A2277712
2-Chlorocinnamic acid, predominantly trans , 99% , 3752-25-8
CAS NO.：3752-25-8
Empirical Formula: C9H7ClO2
Molecular Weight: 182.6
MDL number: MFCD00004372
EINECS: 223-154-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB106.40 | In Stock |
|
| 500G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C(lit.) |
| Boiling point: | 260.71°C (rough estimate) |
| Density | 1.2377 (rough estimate) |
| refractive index | 1.5426 (estimate) |
| storage temp. | Room temperature. |
| Water Solubility | Insoluble in water |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 4.23(at 25℃) |
| color | White to Almost white |
| BRN | 1365198 |
| InChI | InChI=1S/C9H7ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6H,(H,11,12) |
| InChIKey | KJRRTHHNKJBVBO-AATRIKPKSA-N |
| SMILES | C(O)(=O)C=CC1=CC=CC=C1Cl |
| CAS DataBase Reference | 3752-25-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chlorocinnamic acid(3752-25-8) |
Description and Uses
2-Chlorocinnamic acid is a kind of trans-cinnamate. It is used in organic synthesis.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H301-H335 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 36-26-36/37 |
| WGK Germany | 3 |
| RTECS | GD8450000 |
| Hazard Note | Irritant |
| HS Code | 29124990 |
