A2277812
2-Chlorophenylacetic acid , 99% , 2444-36-2
CAS NO.:2444-36-2
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00004317
EINECS: 219-482-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB57.60 | In Stock |
|
| 500G | RMB212.00 | In Stock |
|
| 2.5kg | RMB948.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C(lit.) |
| Boiling point: | 145°C 5mm |
| Density | 1.2315 (rough estimate) |
| refractive index | 1.5660 (estimate) |
| Flash point: | 145°C/5mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 4.07(at 25℃) |
| color | White to light yellow |
| BRN | 1101523 |
| InChI | InChI=1S/C8H7ClO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | IUJAAIZKRJJZGQ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1Cl |
| CAS DataBase Reference | 2444-36-2(CAS DataBase Reference) |
Description and Uses
2-Chlorophenylacetic acid has been used in the synthesis of phenylacetoxy cellulosics and its halogenated derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-36 |
| WGK Germany | 3 |
| F | 13 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |





