A2278012
7-Chloroquinaldine , 99% , 4965-33-7
Synonym(s):
7-Chloro-2-methylquinoline
CAS NO.:4965-33-7
Empirical Formula: C10H8ClN
Molecular Weight: 177.63
MDL number: MFCD00075436
EINECS: 440-600-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB299.20 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-78 °C (lit.) |
| Boiling point: | 87 °C / 0.5mmHg |
| Density | 1.1810 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.25±0.50(Predicted) |
| color | Pale Yellow to Light Beige |
| BRN | 115318 |
| InChI | InChI=1S/C10H8ClN/c1-7-2-3-8-4-5-9(11)6-10(8)12-7/h2-6H,1H3 |
| InChIKey | WQZQFYRSYLXBGP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Cl)C=2)C=CC=1C |
| CAS DataBase Reference | 4965-33-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 7-chloro-2-methyl-(4965-33-7) |
Description and Uses
7-Chloroquinaldine is used as the starting material in the synthesis of (E)-1-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-2-propen-1-ol (C381415); an intermediate in the synthesis of the antiasthmatic, Montelukast Sodium Salt (M568000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





