A2282712
2-Chlorothioxanthen-9-one , 98% , 86-39-5
CAS NO.:86-39-5
Empirical Formula: C13H7ClOS
Molecular Weight: 246.71
MDL number: MFCD00005067
EINECS: 201-667-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB53.60 | In Stock |
|
| 25G | RMB101.60 | In Stock |
|
| 100G | RMB213.60 | In Stock |
|
| 500g | RMB1015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152.5-153.5 °C(lit.) |
| Boiling point: | 409.4±44.0 °C(Predicted) |
| Density | 1.53 g/cm3 |
| Flash point: | 196 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| color | Light yellow to Yellow to Green |
| Water Solubility | Partly miscible in water. |
| InChI | InChI=1S/C13H7ClOS/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H |
| InChIKey | ZCDADJXRUCOCJE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)SC2=C1C=C(Cl)C=C2 |
| CAS DataBase Reference | 86-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | 9H-Thioxanthen-9-one, 2-chloro- (86-39-5) |
Description and Uses
2-Chlorothioxanthone is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H228 |
| Precautionary statements | P210-P240-P241-P280-P370+P378 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 2 |





