A2284212
2-Chloro-4-nitrophenol , 97% , 619-08-9
CAS NO.：619-08-9
Empirical Formula: C6H4ClNO3
Molecular Weight: 173.55
MDL number: MFCD00043910
EINECS: 210-578-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB148.80 | In Stock |
|
| 500G | RMB595.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-106 °C (lit.) |
| Boiling point: | 290.6±25.0 °C(Predicted) |
| Density | 1.4914 (rough estimate) |
| vapor pressure | 0.133Pa at 25℃ |
| refractive index | 1.5810 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder or Crystals |
| pka | 5.43±0.22(Predicted) |
| color | White to beige |
| Water Solubility | slightly soluble |
| BRN | 2046372 |
| InChI | 1S/C6H4ClNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H |
| InChIKey | BOFRXDMCQRTGII-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1Cl)[N+]([O-])=O |
| LogP | 2.55 |
| CAS DataBase Reference | 619-08-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chloro-4-nitrophenol(619-08-9) |
| EPA Substance Registry System | Phenol, 2-chloro-4-nitro- (619-08-9) |
Description and Uses
2-Chloro-4-nitrophenol, is frequently used as building blocks for dyes, plastics, explosives. It acts as a catalytic agent, petrochemical additive and used in organic synthesis. It can react with sulfuric acid dimethyl ester to produce 2-chloro-4-nitro-anisole. This reaction will need reagents K2CO3 and xylene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | SK5075000 |
| TSCA | TSCA listed |
| HS Code | 29089000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
