A2286112
Cobaltous naphthenate , CO7.8-8.2%, solvent: 40%-80%mineral oil , 61789-51-3
CAS NO.：61789-51-3
Empirical Formula: C22H16CoO4
Molecular Weight: 403.293
MDL number: MFCD25292994
EINECS: 263-064-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-7℃ |
| Density | 0.921 g/mL at 25 °C |
| vapor pressure | 0Pa at 20℃ |
| refractive index | n |
| Flash point: | 120 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 0.95 |
| color | dark |
| Water Solubility | Insoluble in water. |
| InChI | 1S/2C10H18O2.Co/c2*1-2-8-3-4-9(7-8)5-6-10(11)12;/h2*8-9H,2-7H2,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | XSWKLHINRKWMTD-UHFFFAOYSA-L |
| SMILES | [Co+2].[O-]C(=O)CCC2CC(CC2)CC.[O-]C(=O)CCC1CC(CC1)CC |
| EPA Substance Registry System | Cobalt naphthenate (61789-51-3) |
Description and Uses
Cobalt naphthenate is a brown powder or bluish-red solid; Freezing/Melting point =140℃; Flashpoint =49℃; Autoignition temperature =276℃. HazardIdentification (based on NFPA-704 M Rating System):Health 1, Flammability 2, Reactivity 0. Insoluble in water.
Cobalt naphthenate may be used as a catalyst that facilitates the free radical polymerization of (3-methacryloxypropyl)trimethoxysilane (MPS), which can be used to functionalize alumina nanoparticles. It can be used as a promoter for the development of unsaturated flame retardant polyesters.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H304-H317-H361fd-H372-H372-H412 |
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P331 |
| target organs | Central nervous system, Gastrointestinal tract |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,T |
| Risk Statements | 49-10-36/38-42/43-50/53-40-65 |
| Safety Statements | 53-23-45-60-61-36/37-62 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | QK8925000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Flam. Liq. 3 Repr. 2 Skin Sens. 1 STOT RE 1 STOT RE 1 Oral |
