A2299712
N-Carbobenzyloxy-L-aspartic acid , 99% , 1152-61-0
Synonym(s):
Z-L -aspartic acid;Z-Asp-OH
CAS NO.:1152-61-0
Empirical Formula: C12H13NO6
Molecular Weight: 267.23
MDL number: MFCD00002719
EINECS: 214-568-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB80.00 | In Stock |
|
| 100G | RMB246.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C (lit.) |
| Boiling point: | 410.42°C (rough estimate) |
| alpha | 10.5 º (c=1,AcOH) |
| Density | 1.3276 (rough estimate) |
| refractive index | 9.5 ° (C=7, AcOH) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| pka | 3.75±0.23(Predicted) |
| form | Fine Crystalline Powder |
| color | White |
| optical activity | [α]23/D +8.6°, c = 7 in acetic acid |
| BRN | 2336722 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H13NO6/c14-10(15)6-9(11(16)17)13-12(18)19-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,18)(H,14,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | XYXYXSKSTZAEJW-VIFPVBQESA-N |
| SMILES | OC(=O)C[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 1152-61-0(CAS DataBase Reference) |
| EPA Substance Registry System | N-Carbobenzyloxy-L-aspartic acid (1152-61-0) |
Description and Uses
N-Cbz-L-aspartic acid is an N-Cbz-protected form of L-Aspartic acid (A790024). L-Aspartic acid is a nonessential amino acid that is used to biosynthesize other amino acids within the human body. L-Aspartic acid also increases membrane conductance of mammalian neurons by voltage-dependent means, causing depolarization and nerve impulses that travel to key areas of the central nervous system.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








