A2299812
N-Carbobenzyloxy-L-valine , 99% , 1149-26-4
Synonym(s):
N-Cbz-L -Valine;Z-L -Valine;Z-Val-OH
CAS NO.:1149-26-4
Empirical Formula: C13H17NO4
Molecular Weight: 251.28
MDL number: MFCD00008922
EINECS: 214-562-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 1G | RMB23.20 | In Stock |
|
| 25G | RMB52.80 | In Stock |
|
| 100G | RMB121.60 | In Stock |
|
| 250G | RMB255.20 | In Stock |
|
| 500G | RMB415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C(lit.) |
| alpha | -4 º (c=2,acetic acid) |
| Boiling point: | 394.43°C (rough estimate) |
| Density | 0,926g/cm |
| refractive index | -4.3 ° (C=2, AcOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetic Acid, DMSO (Slightly), Ethanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.00±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 4.2±0.5°, c = 2 in chloroform |
| BRN | 2056617 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H17NO4/c1-9(2)11(12(15)16)14-13(17)18-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,14,17)(H,15,16)/t11-/m0/s1 |
| InChIKey | CANZBRDGRHNSGZ-NSHDSACASA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 1149-26-4(CAS DataBase Reference) |
Description and Uses
N-Cbz-L-valine is an N-Cbz-protected form of L-Valine (V094205). L-Valine is an essential amino acid that is used as an ingredient in cosmetic formulations, pharmaceuticals, and animal feed products. L-valine is also important for growth and ammonia detoxification in humans.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H334 |
| Precautionary statements | P261-P342+P311 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 38-43-36/37/38-20/21/22 |
| Safety Statements | 36/37-36-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







