A2302912
2-Chloro-L-phenylalanine , 98% , 103616-89-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB77.60 | In Stock |
|
| 5G | RMB284.80 | In Stock |
|
| 25G | RMB927.20 | In Stock |
|
| 100g | RMB2316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-235°C |
| Boiling point: | 339.5±32.0 °C(Predicted) |
| Density | 1.336±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| pka | 2.16±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C9H10ClNO2/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | CVZZNRXMDCOHBG-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1Cl)N |
| CAS DataBase Reference | 103616-89-3(CAS DataBase Reference) |
Description and Uses
The largest gain in affinity of all tested unnatural amino acids was observed for 2-chloro-L-phenylalanine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
