A2304712
O-(6-Chlorobenzotriazol-1-yl)-N,N,N′,N′-tetramethyluronium hexafluorophosphate , 98% , 330645-87-9
Synonym(s):
N,N,N′,N′-Tetramethyl-O-(6-chloro-1H-benzotriazol-1-yl)uronium hexafluorophosphate;1-[Bis(dimethylamino)methylen]-5-chlorobenzotriazolium 3-oxide hexafluorophosphate;2-(6-Chloro-1-H-benzotriazole-1-yl)-1,1,3,3-tetramethylaminium hexafluorophosphate;HCTU
CAS NO.:330645-87-9
Empirical Formula: C11H15ClF6N5OP
Molecular Weight: 413.69
MDL number: MFCD04973268
EINECS: 608-825-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB152.00 | In Stock |
|
| 500G | RMB727.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-190 °C |
| storage temp. | Store at +2°C to +8°C. |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H15ClN5O.F6P/c1-14(2)11(15(3)4)16-9-6-5-8(12)7-10(9)17(18)13-16;1-7(2,3,4,5)6/h5-7H,1-4H3;/q+1;-1 |
| InChIKey | ZHHGTMQHUWDEJF-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].C(=[N+]1/N=N(=O)C2=CC(Cl)=CC=C/12)(\N(C)C)/N(C)C |
| CAS DataBase Reference | 330645-87-9(CAS DataBase Reference) |
Description and Uses
Reagent for:
Synthesis of near-infrared pH activatable fluorescent probes
Synthesis of human β-amyloid by Fmoc chemistry
Stereoselective Horner-Wadsworth-Emmons olefination
Covalent ligation of fluorescent peptides to quantum dots
Alkylation of human telomere sequence
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1A |






