A2306012
3-Chlorophenylacetic acid , 98% , 1878-65-5
CAS NO.:1878-65-5
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00004332
EINECS: 217-520-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB189.60 | In Stock |
|
| 250g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-79 °C (lit.) |
| Boiling point: | 241.44°C (rough estimate) |
| Density | 1.2315 (rough estimate) |
| refractive index | 1.5660 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear, colorless |
| pka | 4.14(at 25℃) |
| form | Shiny Flakes and Chunks |
| color | White |
| BRN | 2045103 |
| InChI | InChI=1S/C8H7ClO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | WFPMUFXQDKMVCO-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(Cl)=C1 |
| CAS DataBase Reference | 1878-65-5(CAS DataBase Reference) |
| NIST Chemistry Reference | (M-chlorophenyl)acetic acid(1878-65-5) |
| EPA Substance Registry System | 3-Chlorophenylacetic acid (1878-65-5) |
Description and Uses
Ortho-, meta-, and para-chlorophenylacetic acids are all potent plant growth regulators and herbicides. 3-Chlorophenylacetic acid is the meta-isomer among them. Chlorophenylacetic acids are used in the synthesis of oxindoles and organoantimony complexes; the resulting compounds exhibit biocidal, fungicidal, and antioxidant properties[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |



