A2308412
2-Chloronicotinic acid , 98% , 2942-59-8
Synonym(s):
2-Chloronicotinic acid;2-Chloropyridine-3-carboxylic acid
CAS NO.:2942-59-8
Empirical Formula: C6H4ClNO2
Molecular Weight: 157.55
MDL number: MFCD00006236
EINECS: 220-937-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB56.00 | In Stock |
|
| 500G | RMB216.00 | In Stock |
|
| 2.5kg | RMB876.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-178 °C (dec.)(lit.) |
| Boiling point: | 316.8±22.0 °C(Predicted) |
| Density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO, Ethyl Acetate (Slightly) |
| pka | 2.07±0.25(Predicted) |
| form | Powder |
| color | White to cream |
| Odor | Pungent odor |
| BRN | 119023 |
| InChI | InChI=1S/C6H4ClNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H,9,10) |
| InChIKey | IBRSSZOHCGUTHI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1C(O)=O |
| LogP | 0.988 |
| CAS DataBase Reference | 2942-59-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloronicotinic acid (2942-59-8) |
Description and Uses
2-Chloronicotinic Acid is used in the preparation of 4-thiazolidinone derivatives and Schiff bases displaying antimicrobial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






