A2313412
(+)-Camphoric acid , 99% , 124-83-4
Synonym(s):
(+)-Camphoric acid;(1R,3S)-1,2,2-Trimethyl-1,3-cyclopentanedicarboxylic acid
CAS NO.:124-83-4
Empirical Formula: C10H16O4
Molecular Weight: 200.23
MDL number: MFCD00001375
EINECS: 204-715-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB364.80 | In Stock |
|
| 250g | RMB799.20 | In Stock |
|
| 500G | RMB1799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-189 °C |
| alpha | 46.5 º (c=10, C2H5OH) |
| Boiling point: | 297.96°C (rough estimate) |
| Density | 1.1860 |
| refractive index | 1.4459 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | pK1: 4.57;pK2: 5.10 (25°C) |
| color | White |
| optical activity | [α]20/D 46°, c = 1 in ethanol |
| Water Solubility | 0.8 g/100 mL |
| Merck | 14,1733 |
| BRN | 2050204 |
| InChI | 1S/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m1/s1 |
| InChIKey | LSPHULWDVZXLIL-LDWIPMOCSA-N |
| SMILES | CC1(C)[C@H](CC[C@@]1(C)C(O)=O)C(O)=O |
| CAS DataBase Reference | 124-83-4(CAS DataBase Reference) |
| NIST Chemistry Reference | D-camphoric acid(124-83-4) |
| EPA Substance Registry System | 1,3-Cyclopentanedicarboxylic acid, 1,2,2-trimethyl-, (1R,3S)- (124-83-4) |
Description and Uses
D-(+)-Camphoric acid is used primarily as a reagent in syntheses of crystalline structures. It is used in the preparation of polymeric transition metal dipyridylamine D-camphorate complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







