A2320912
2-(Chloromethyl)-4-methoxy-3,5-dimethylpyridine Hydrochloride , 98% , 86604-75-3
CAS NO.：86604-75-3
Empirical Formula: C9H13Cl2NO
Molecular Weight: 222.11
MDL number: MFCD00277472
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100g | RMB248.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-131 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Sparingly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C9H12ClNO.ClH/c1-6-5-11-8(4-10)7(2)9(6)12-3;/h5H,4H2,1-3H3;1H |
| InChIKey | LCJDHJOUOJSJGS-UHFFFAOYSA-N |
| SMILES | C1(CCl)=NC=C(C)C(OC)=C1C.[H]Cl |
| CAS DataBase Reference | 86604-75-3(CAS DataBase Reference) |
Description and Uses
2-Chloromethyl-4-methoxy-3,5-dimethylpyridine hydrochloride is used as pharmaceutical intermediates. It is an intermediate in the production of the antiulcer agent Omeprazole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335-H413 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29333990 |
