A2322712
L-Cystine , Analysis of standard products, ≥99.5% , 56-89-3
Synonym(s):
Cys;L-Cystine;L-Cystine - CAS 56-89-3 - Calbiochem;Nephrin;NPHN
CAS NO.:56-89-3
Empirical Formula: C6H12N2O4S2
Molecular Weight: 240.3
MDL number: MFCD00064228
EINECS: 200-296-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB127.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >240 °C (dec.) (lit.) |
| Boiling point: | 468.2±45.0 °C(Predicted) |
| alpha | -224 º(c=2 in 1M HCl) |
| Density | 1.68 |
| bulk density | 300kg/m3 |
| refractive index | -222.5 ° (C=1, 1mol/L HCl) |
| storage temp. | 2-8°C |
| solubility | 1 M HCl: 100 mg/mL |
| form | Powder/Solid |
| pka | 1.0, 2.1, 8.02, 8.71(at 25℃) |
| color | White |
| PH | 4.60 |
| biological source | plant |
| optical activity | [α]20/D 219±5°, c = 1% in 1 M HCl |
| Water Solubility | 0.112 g/L (25 ºC) |
| Merck | 14,2782 |
| BRN | 1728094 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | peptide synthesis |
| Cosmetics Ingredients Functions | FRAGRANCE HAIR CONDITIONING ANTISTATIC |
| InChI | 1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | LEVWYRKDKASIDU-IMJSIDKUSA-N |
| SMILES | N[C@@H](CSSC[C@H](N)C(O)=O)C(O)=O |
| LogP | 0.773 (est) |
| CAS DataBase Reference | 56-89-3(CAS DataBase Reference) |
| NIST Chemistry Reference | L-Cystine(56-89-3) |
| EPA Substance Registry System | L-Cystine (56-89-3) |
Description and Uses
L-Cystine is a non-essential amino acid for human development. L-Cystine is formed by the dimerization of two cysteines through the sulfur.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | HA2690000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| PackingGroup | III |
| HS Code | 29309014 |
| Storage Class | 11 - Combustible Solids |





