A2330012
4-Chloro-3-sulfamoylbenzoic acid , 98% , 1205-30-7
CAS NO.：1205-30-7
Empirical Formula: C7H6ClNO4S
Molecular Weight: 235.64
MDL number: MFCD00012375
EINECS: 214-882-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB236.80 | In Stock |
|
| 250g | RMB719.20 | In Stock |
|
| 500G | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 256-258 °C (lit.) |
| Boiling point: | 502.4±60.0 °C(Predicted) |
| Density | 1.649±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.44±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C7H6ClNO4S/c8-5-2-1-4(7(10)11)3-6(5)14(9,12)13/h1-3H,(H,10,11)(H2,9,12,13) |
| InChIKey | FHQAWINGVCDTTG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C(S(N)(=O)=O)=C1 |
| CAS DataBase Reference | 1205-30-7(CAS DataBase Reference) |
Description and Uses
4-Chloro-3-sulfamoylbenzoic Acid (cas# 1205-30-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG5642600 |
| HS Code | 29350090 |
| Toxicity | mouse,LD50,intravenous,> 2gm/kg (2000mg/kg),BEHAVIORAL: ATAXIABEHAVIORAL: TREMORLUNGS, THORAX, OR RESPIRATION: RESPIRATORY DEPRESSION,Kiso to Rinsho. Clinical Report. Vol. 16, Pg. 2275, 1982. |
