A2333412
5-Chlorosalicylaldehyde , 98% , 635-93-8
CAS NO.：635-93-8
Empirical Formula: C7H5ClO2
Molecular Weight: 156.57
MDL number: MFCD00003331
EINECS: 211-244-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB187.20 | In Stock |
|
| 500g | RMB822.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-102 °C(lit.) |
| Boiling point: | 217.69°C (rough estimate) |
| Density | 1.2683 (rough estimate) |
| refractive index | 1.5812 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 7.73±0.18(Predicted) |
| form | Crystalline Powder |
| color | White to very slightly yellow |
| Sensitive | Air Sensitive |
| BRN | 636632 |
| InChI | InChI=1S/C7H5ClO2/c8-6-1-2-7(10)5(3-6)4-9/h1-4,10H |
| InChIKey | FUGKCSRLAQKUHG-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Cl)=CC=C1O |
| LogP | 2.570 (est) |
| CAS DataBase Reference | 635-93-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-hydroxy benzaldehyde(635-93-8) |
| EPA Substance Registry System | Benzaldehyde, 5-chloro-2-hydroxy- (635-93-8) |
Description and Uses
5-Chlorosalicyaldehyde is a useful synthetic intermediate and a key precursor to a variety chelating agents.5-Chlorosalicyaldehyde is used to synthesize imine resveratrol (R150000) derivatives as multi-targeted agents against Alzheimer's disease.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25-36/37/39 |
| RIDADR | UN2811/6.1/PG III |
| WGK Germany | 3 |
| RTECS | VN5450000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 9 |
| HS Code | 29130000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
