A2337112
λ-Cyhalothrin solution , analyticalstandard,100ug/mlinpetroleumether , 91465-08-6
CAS NO.:91465-08-6
Empirical Formula: C23H19ClF3NO3
Molecular Weight: 449.85
MDL number: MFCD02181175
EINECS: 415-130-7
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB126.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49.2°C |
| Boiling point: | 187-190°C |
| Density | 1.3225 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to off-white |
| Merck | 13,2787 |
| Stability: | Light Sensitive |
| InChI | 1S/C23H19ClF3NO3/c1-22(2)17(12-19(24)23(25,26)27)20(22)21(29)31-18(13-28)14-7-6-10-16(11-14)30-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/b19-12-/t17-,18+,20-/m0/s1 |
| InChIKey | ZXQYGBMAQZUVMI-GCMPRSNUSA-N |
| SMILES | CC1(C)[C@@H](\C=C(/Cl)C(F)(F)F)[C@H]1C(=O)O[C@H](C#N)c2cccc(Oc3ccccc3)c2 |
| LogP | 7.000 |
| CAS DataBase Reference | 91465-08-6(CAS DataBase Reference) |
| NIST Chemistry Reference | «LAMBDA»-cyhalothrin(91465-08-6) |
| EPA Substance Registry System | .lambda.-Cyhalothrin (91465-08-6) |
Description and Uses
Insecticide; pyrethrin analog
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H330-H410 |
| Precautionary statements | P260-P264-P273-P280-P302+P352+P312-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+;N,N,T+,Xn |
| Risk Statements | 21-25-26-50/53-20/21/22 |
| Safety Statements | 1/2-28-36/37/39-38-45-60-61-13 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GZ1227780 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | LD50 (technical grade) in male, female rats (mg/kg): 79, 56 orally; 632, 696 dermally (Jutsum) |








