Chrysin , 98% , 480-40-0
Synonym(s):
5,7-Dihydroxyflavone
CAS NO.:480-40-0
Empirical Formula: C15H10O4
Molecular Weight: 254.24
MDL number: MFCD00006834
EINECS: 207-549-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB567.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 284-286 °C(lit.) |
| Boiling point: | 357.45°C (rough estimate) |
| Density | 1.2693 (rough estimate) |
| refractive index | 1.4872 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 6.50±0.40(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| λmax | 348 nm |
| Merck | 14,2256 |
| BRN | 233276 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | RTIXKCRFFJGDFG-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2C(=O)C=C(Oc2c1)c3ccccc3 |
| LogP | 3.520 |
| CAS DataBase Reference | 480-40-0(CAS DataBase Reference) |
Description and Uses
Chrysin is a natural flavonoid with antioxidant, anti-inflammatory, and anticancer properties. It blocks COX-2 gene expression, PGE2 production, and hydroxyl radical formation in LPS-induced RAW 264.7 cells. Chrysin inhibits insulin-induced HIF-1α expression (~50% at 10 μM) in human prostate cancer DU145 cells and blocks DU145 xenograft-induced angiogenesis in vivo. In a mouse model of ischemia/reperfusion injury, chrysin decreased pro-inflammatory gene expression and oxidative stress, resulting in a reduction of infarct volume and neurological defects.
Chrysin is a flavanoid with anti-inflammatory effect and potential protective effects against cancer and cardiovascular disease. Studies show that Chrysin is central benzodiazepine receptor ligand with possible anxiolytic effects. Chrysin was initially believed to have aromatase inhibitor but recent in vivo studies have disproved that. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | LK8329050 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |




