A2340912
4-Chloro-4'-hydroxybenzophenone , 98% , 42019-78-3
CAS NO.:42019-78-3
Empirical Formula: C13H9ClO2
Molecular Weight: 232.66
MDL number: MFCD00002357
EINECS: 255-627-4
| Pack Size | Price | Stock | Quantity |
| 10G | RMB23.20 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB32.00 | In Stock |
|
| 50G | RMB54.40 | In Stock |
|
| 100G | RMB71.20 | In Stock |
|
| 250G | RMB120.80 | In Stock |
|
| 500G | RMB295.20 | In Stock |
|
| 1kg | RMB532.80 | In Stock |
|
| 2.5kg | RMB919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-181 °C |
| Boiling point: | 257 °C (13 mmHg) |
| Density | 1.2082 (rough estimate) |
| refractive index | 1.5434 (estimate) |
| Flash point: | 100 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 7.68±0.15(Predicted) |
| form | solid |
| color | Pale Beige to Light Brown |
| BRN | 2049956 |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C13H9ClO2/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,15H |
| InChIKey | RUETVLNXAGWCDS-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(C1=CC=C(O)C=C1)=O |
| CAS DataBase Reference | 42019-78-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (4-chlorophenyl)(4-hydroxyphenyl)-(42019-78-3) |
Description and Uses
4-Chloro-4’-hydroxybenzophenone (Fenofibrate EP Impurity A; Fenofibrate USP Related Compound A) the impurity of Fenofibric acid (42017-89-0), the active metabolite of fenofibrate which increases Apolipoprotein A-I–Mediated High-Density Lipoprotein Biogenesis by enhancing transcription of ATP-Binding cassette transporter A1 gene in a liver X receptor–dependent manner.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P305+P351+P338-P261-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 24/25-37/39-26-36 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 29144000 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |



![Ethyl2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate](https://img.chemicalbook.com/CAS/GIF/42019-08-9.gif)


![FENOFIBRATE RELATED COMPOUND C (25 MG) (1-METHYLETHYL 2-[[2-[4-(4-CHLOROBENZOYL)PHENOXY]-2-METHYLPROPANOYL]OXY]-2-METHYLPROPANOATE)](https://img.chemicalbook.com/CAS/GIF/217636-48-1.gif)