A2341112
N-(2-Chlorobenzyloxycarbonyloxy)succinimide , 98% , 65853-65-8
Synonym(s):
N-(2-Chlorobenzyloxycarbonyloxy)succinimide;O-(2-Chlorobenzyloxycarbonyl)-N-hydroxysuccinimide;Z(2-Cl)-OSu
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB136.00 | In Stock |
|
| 100G | RMB369.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105 °C(lit.) |
| Boiling point: | 397.4±44.0 °C(Predicted) |
| Density | 1.4000 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder |
| Major Application | peptide synthesis |
| InChI | 1S/C12H10ClNO5/c13-9-4-2-1-3-8(9)7-18-12(17)19-14-10(15)5-6-11(14)16/h1-4H,5-7H2 |
| InChIKey | LVZHXYXNMHCBKC-UHFFFAOYSA-N |
| SMILES | Clc1c(cccc1)COC(=O)ON2C(=O)CCC2=O |
| CAS DataBase Reference | 65853-65-8(CAS DataBase Reference) |
Description and Uses
N-(2-Chlorobenzyloxycarbonyloxy)succinimide is a reagent used to introduce the 2-chloro-Z group for protection of the side chain function of lysine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933 79 00 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |
