A2341412
D-Cysteine hydrochloride monohydrate , 98% , 32443-99-5
CAS NO.：32443-99-5
Empirical Formula: C3H7NO2S.ClH.H2O
Molecular Weight: 175.63
MDL number: MFCD00012632
EINECS: 251-043-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB312.00 | In Stock |
|
| 500g | RMB1208.80 | In Stock |
|
| 2.5kg | RMB4223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~185 °C (dec.) |
| alpha | -6.4 º (c=5%,5M HCl) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 5645478 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/t2-;/s3 |
| InChIKey | IFQSXNOEEPCSLW-NNUCSGGJNA-N |
| SMILES | [C@@H](N)(CS)C(=O)O.Cl |&1:0,r| |
| CAS DataBase Reference | 32443-99-5(CAS DataBase Reference) |
Description and Uses
D-Cysteine hydrochloride is a new insecticide used as mosquito-repellent, toilet water, perfume, emulsion or aerosol
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 29309010 |
| Storage Class | 11 - Combustible Solids |
