PRODUCT Properties
| Melting point: | 25-28°C |
| Boiling point: | 112-117 °C (lit.) |
| Density | 1.623 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | solid |
| Specific Gravity | 1.623 |
| color | Colorless to Yellow to Orange |
| Water Solubility | Not miscible in water. |
| Sensitive | Moisture Sensitive |
| BRN | 130710 |
| InChI | InChI=1S/C4H2Cl2O2S2/c5-3-1-2-4(9-3)10(6,7)8/h1-2H |
| InChIKey | SORSTNOXGOXWAO-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)SC(Cl)=CC=1 |
| CAS DataBase Reference | 2766-74-7(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-thiophenesulfonyl Chloride is a sulfonylthiophene derivative used in the preparation of Notch-1-sparing γ-secretase inhibitors for the treatment of Alzheimer's disease.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34-29-14 |
| Safety Statements | 26-27-36/37/39-45-28A-25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29349990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
