A2346512
2-Chloroanisole , 99% , 766-51-8
CAS NO.：766-51-8
Empirical Formula: C7H7ClO
Molecular Weight: 142.58
MDL number: MFCD00000557
EINECS: 212-167-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB69.60 | In Stock |
|
| 50g | RMB111.20 | In Stock |
|
| 100G | RMB204.80 | In Stock |
|
| 500G | RMB918.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -26.8°C |
| Boiling point: | 195-196 °C (lit.) |
| Density | 1.123 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 169 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear light yellow |
| Water Solubility | 0.49g/L(25 ºC) |
| BRN | 2042179 |
| InChI | InChI=1S/C7H7ClO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| InChIKey | QGRPVMLBTFGQDQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC=C1OC |
| CAS DataBase Reference | 766-51-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-2-methoxy-(766-51-8) |
| EPA Substance Registry System | o-Chloroanisole (766-51-8) |
Description and Uses
2-Chloroanisole was used in headspace solid-phase microextraction method for the determination of haloanisoles in wine and spirit samples.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29093090 |
