A2349812
CHES , ≥99.0%(T) , 103-47-9
Synonym(s):
2-(Cyclohexylamino)ethanesulfonic acid;2-(N-Cyclohexylamino)Ethanesulfonic Acid;CHES
CAS NO.:103-47-9
Empirical Formula: C8H17NO3S
Molecular Weight: 207.29
MDL number: MFCD00003835
EINECS: 203-115-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB203.20 | In Stock |
|
| 500G | RMB820.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C |
| Density | 1.2045 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5364 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | H2O: 0.5 M at 20 °C, clear, colorless |
| form | Solid |
| color | White |
| Odor | Odorless |
| PH | 3.0-5.0 (25℃, 0.5M in H2O) |
| PH Range | 8.6 - 10.0 |
| pka | 9.3(at 25℃) |
| Water Solubility | Soluble |
| λmax | λ: 260 nm Amax: 0.08 λ: 280 nm Amax: 0.05 |
| Sensitive | Hygroscopic |
| Merck | 14,2055 |
| BRN | 2967601 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H17NO3S.Na/c10-13(11,12)7-6-9-8-4-2-1-3-5-8;/h8-9H,1-7H2,(H,10,11,12);/q;+1/p-1 |
| InChIKey | MKWKNSIESPFAQN-UHFFFAOYSA-N |
| SMILES | [Na+].[S](=O)(=O)([O-])CCNC1CCCCC1 |
| LogP | -2.2 at 20℃ |
| CAS DataBase Reference | 103-47-9(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanesulfonic acid, 2-(cyclohexylamino)- (103-47-9) |
| Absorption | ≤0.05 at 280 in H2O at 0.5M ≤0.08 at 260 in H2O at 0.5M |
Description and Uses
2-(Cyclohexylamino)ethanesulfonic acid (CHES) has been used in the preparation of dimethyl trisulfide- polysorbate 80 (DMTS-PS80) formulation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P280i-P305+P351+P338-P337+P313-P264-P280-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36-20/22 |
| Safety Statements | 26-28-24/25-16-60 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29213099 |
| Storage Class | 13 - Non Combustible Solids |






