A2350412
Chrysoidin , AR , 532-82-1
Synonym(s):
4-Phenylazo-m-phenylenediamine monohydrochloride;Basic Orange 2;Chrysoidine Y
CAS NO.:532-82-1
Empirical Formula: C12H13ClN4
Molecular Weight: 248.71
MDL number: MFCD00012976
EINECS: 208-545-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB168.80 | In Stock |
|
| 100G | RMB600.80 | In Stock |
|
| 250G | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235 °C (dec.)(lit.) |
| Boiling point: | 2262°C |
| Density | 1.2171 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | room temp |
| solubility | Soluble in water, ethanol, acetone, methyl cellosolve, xylene; practically insoluble in Ibenzene |
| Colour Index | 11270 |
| form | Crystalline Powder |
| color | Bordeaux to deep purple |
| PH Range | Orange (4.0) to yellow (7.0) |
| Odor | Odorless |
| λmax | 449nm |
| Merck | 13,2279 |
| BRN | 3724653 |
| Major Application | Recording materials, waveguides, thin solid films, photographic materials, printing plates, inks, toners, detergents, corrosion inhibitors, rubber, textiles, hair dyes |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C12H12N4.ClH/c13-9-6-7-12(11(14)8-9)16-15-10-4-2-1-3-5-10;/h1-8H,13-14H2;1H |
| InChIKey | MCTQNEBFZMBRSQ-GEEYTBSJSA-N |
| SMILES | Cl[H].Nc1ccc(N=Nc2ccccc2)c(N)c1 |
| CAS DataBase Reference | 532-82-1(CAS DataBase Reference) |
| IARC | 3 (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System | C.I. Basic Orange 2, monohydrochloride (532-82-1) |
Description and Uses
Orange dye for cotton and silk.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H341-H410 |
| Precautionary statements | P201-P273-P280-P301+P312+P330-P305+P351+P338+P310-P308+P313 |
| Hazard Codes | N,Xn |
| Risk Statements | 50/53-68-41-38-22 |
| Safety Statements | 60-61-46-36/37/39-26-23 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | ST3380000 |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Muta. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 532-82-1(Hazardous Substances Data) |
| Toxicity | mma-sat 50 mg/plate MUREAV 44,9,77 |








