A2352912
cis-5-Norbornene-exo-2,3-dicarboxylic anhydride , 95% , 2746-19-2
Synonym(s):
cis -Norbornene-exo -2,3-dicarboxylic anhydride;cis -5-Norbornene-exo -2,3-dicarboxylic anhydride;cis -5-Norbornene-exo -anhydride;exo -cis -5-Norbornene-2,3-dicarboxylic anhydride;exo -5-Norbornene-2,3-dicarboxylic anhydride
CAS NO.:2746-19-2
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00630580
EINECS: 220-384-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 500g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-145 °C(lit.) |
| Boiling point: | 331.1±42.0 °C(Predicted) |
| Density | 1.405±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2/t4-,5+,6+,7- |
| InChIKey | KNDQHSIWLOJIGP-RNGGSSJXSA-N |
| SMILES | C1(=O)[C@]2([H])[C@@]([H])([C@]3([H])C[C@@]2([H])C=C3)C(=O)O1 |&1:2,4,6,9,r| |
| LogP | -0.102 (est) |
| CAS DataBase Reference | 2746-19-2 |
| EPA Substance Registry System | 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-, (3aR,4R,7S,7aS)-rel- (2746-19-2) |
Description and Uses
cis-5-Norbornene-exo-2,3-dicarboxylic anhydride is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H334 |
| Precautionary statements | P261-P280-P305+P351+P338-P342+P311 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 37/38-41-42/43 |
| Safety Statements | 26-36-37/39-24-22 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |




