A2354812
Cadmium acetate dihydrate , AR , 5743-04-4
Synonym(s):
Cadmium Acetate;Cadmium acetate dihydrate
CAS NO.:5743-04-4
Empirical Formula: C4H10CdO6
Molecular Weight: 266.53
MDL number: MFCD00150020
EINECS: 611-525-5
| Pack Size | Price | Stock | Quantity |
| 100G | RMB52.00 | In Stock |
|
| 500G | RMB144.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254°C |
| bulk density | 950kg/m3 |
| Density | 2,01 g/cm3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | very soluble in H2O; soluble in ethanol |
| form | Powder |
| Specific Gravity | 2.341 |
| color | White |
| PH | 7 (50g/l, H2O, 20℃) |
| Odor | Slight acetic acid odor |
| PH Range | 7.1 |
| Water Solubility | Soluble |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Merck | 14,1614 |
| BRN | 3730567 |
| Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 0.002 mg/m3 NIOSH: IDLH 9 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| InChI | 1S/2C2H4O2.Cd.2H2O/c2*1-2(3)4;;;/h2*1H3,(H,3,4);;2*1H2/q;;+2;;/p-2 |
| InChIKey | AUIZLSZEDUYGDE-UHFFFAOYSA-L |
| SMILES | [H]O[H].[H]O[H].CC(=O)O[Cd]OC(C)=O |
| CAS DataBase Reference | 5743-04-4(CAS DataBase Reference) |
Description and Uses
Cadmium acetate dihydrate is in theporcelain productionfor the productionof iridescentused effects.Moreover, it is in theanalytical chemistry,a reagent for the detection ofsulfur,seleniumand tellurium. It is also used as chemical and pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H340-H350-H372-H410 |
| Precautionary statements | P201-P260-P273-P280-P308+P313-P391 |
| target organs | Kidney,Bone |
| Hazard Codes | Xn,N,T |
| Risk Statements | 20/21/22-50/53-45-50 |
| Safety Statements | 60-61-53-45 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | AF7505000 |
| TSCA | No |
| HS Code | 2915 29 00 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Muta. 1B STOT RE 1 Oral |
| Toxicity | LD50 orally in Rabbit: 333 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







