A2361212
Cupric carbonate basic , AR,54-57%Cubasis , 12069-69-1
Synonym(s):
Cupric carbonate basic
CAS NO.:12069-69-1
Empirical Formula: CO3.Cu.CuH2O2
Molecular Weight: 221.11
MDL number: MFCD00010976
EINECS: 235-113-6
| Pack Size | Price | Stock | Quantity |
| 100g | RMB38.40 | In Stock |
|
| 500G | RMB81.60 | In Stock |
|
| 2.5KG | RMB301.60 | In Stock |
|
| 10kg | RMB1507.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C |
| Density | 4 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Slightly) |
| form | Solid |
| Specific Gravity | 4. |
| color | green |
| Water Solubility | Insoluble |
| Merck | 14,2631 |
| Solubility Product Constant (Ksp) | pKsp: 9.86 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | InChI=1S/CH2O3.2Cu.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4 |
| InChIKey | ZMMDPCMYTCRWFF-UHFFFAOYSA-J |
| SMILES | C(=O)([O-])[O-].[Cu](O)O.[Cu+2] |
| CAS DataBase Reference | 12069-69-1(CAS DataBase Reference) |
| EPA Substance Registry System | Copper carbonate, basic (12069-69-1) |
Description and Uses
As seed treatment fungicide; in pyrotechnics; as paint and varnish pigment; in animal and poultry feeds; in sweetening of petrol sour crude stock; in manufacture of other Cu salts.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H319-H410 |
| Precautionary statements | P261-P264-P273-P301+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-50/53 |
| Safety Statements | 26-36-61-60 |
| RIDADR | UN3288 |
| WGK Germany | 2 |
| RTECS | GL6910000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28369911 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| Toxicity | bird - domestic,LD50,oral,900mg/kg (900mg/kg),Pesticide Chemicals Official Compendium, Association of the American Pesticide Control Officials, Inc., 1966. Vol. -, Pg. 258, 1966. |




