A2362212
Citric acid monohydrate , ACS,99.0-102.0% , 5949-29-1
Synonym(s):
2-Hydroxypropane-1,2,3-tricarboxylic acid, Hydroxytricarballylic acid;Citric acid monohydrate
CAS NO.:5949-29-1
Empirical Formula: C6H10O8
Molecular Weight: 210.139
MDL number: MFCD00008765
EINECS: 200-662-2
| Pack Size | Price | Stock | Quantity |
| 500G | RMB55.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135 °C |
| Boiling point: | 56 °C760 mm Hg(lit.) |
| bulk density | 800-1000kg/m3 |
| Density | 0.791 g/mL at 25 °C(lit.) |
| vapor density | 2 (vs air) |
| vapor pressure | 184 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 1 °F |
| storage temp. | no restrictions. |
| solubility | Citric Acid Monohydrate is very soluble in water, freely soluble in ethanol and sparingly soluble in ether. |
| form | Solid |
| pka | 3.138, 4.76, 6.401 |
| Specific Gravity | 0.810 (20/4℃) |
| color | White |
| PH | 1.85 (50g/l, H2O, 25℃) |
| Odor | Typical, practically odorless |
| Water Solubility | 1630 g/L (20 oC) ;H2O: soluble 54% (w/w) at 10°C (Citric acid in water) |
| Sensitive | Hygroscopic |
| Merck | 14,2326 |
| BRN | 4018641 |
| Stability: | Stable. Incompatible with oxidizing agents, bases, reducing agents, nitrates. |
| Cosmetics Ingredients Functions | CHELATING BUFFERING FRAGRANCE |
| InChI | 1S/C6H8O7.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H2 |
| InChIKey | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| SMILES | OC(CC(O)(C(O)=O)CC(O)=O)=O.O |
| CAS DataBase Reference | 5949-29-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Citric acid monohydrate(5949-29-1) |
| EPA Substance Registry System | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, hydrate (1:1) (5949-29-1) |
Description and Uses
Citric Acid Monohydrate is a tricarboxylic acid found in citrus fruits. Citric acid is used as an excipient in pharmaceutical preparations due to its antioxidant properties. It maintains the stability of active ingredients and is used as a preservative. It is also used as an acidulant to control pH and acts as an anticoagulant by chelating calcium in the blood. Additionally, Citric Acid Monohydrate is used as an acidulating, food additive, and synergist in antioxidant mixtures.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36-66-67-41-36/37/38-37/38 |
| Safety Statements | 9-16-26-37/39-36/37/39-36 |
| RIDADR | UN 1090 3/PG 2 |
| WGK Germany | 1 |
| RTECS | AL3150000 |
| TSCA | Yes |
| HS Code | 29181400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 3000 mg/kg |




