A2364212
Nalpha-Carbobenzyloxy-L-arginine , 98.5% , 1234-35-1
Synonym(s):
Nα-Z-L -Arginine;N2-Carbobenzyloxy-L -arginine
CAS NO.：1234-35-1
Empirical Formula: C14H20N4O4
Molecular Weight: 308.33
MDL number: MFCD00001762
EINECS: 214-973-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB31.20 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB282.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-174 °C (dec.)(lit.) |
| alpha | -11 º (c=0.5, 0.5N HCl 24 ºC) |
| Boiling point: | 448.73°C (rough estimate) |
| Density | 1.1765 (rough estimate) |
| refractive index | -10 ° (C=5.5, 0.2mol/L HCl) |
| storage temp. | 2-8°C |
| solubility | DMSO, Water |
| form | Solid |
| pka | 3.90±0.21(Predicted) |
| color | White |
| optical activity | [α]20/D 9±1°, c = 5% in 1 M HCl |
| BRN | 2169267 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H20N4O4/c15-13(16)17-8-4-7-11(12(19)20)18-14(21)22-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,18,21)(H,19,20)(H4,15,16,17)/t11-/m0/s1 |
| InChIKey | SJSSFUMSAFMFNM-NSHDSACASA-N |
| SMILES | NC(=N)NCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 1234-35-1(CAS DataBase Reference) |
| EPA Substance Registry System | L-Arginine, N2-[(phenylmethoxy)carbonyl]- (1234-35-1) |
Description and Uses
Z-L-Arginine is used in the synthesis of renin inhibitors containing phosphorous acid derivatives at the scissile bond. Also used in the synthesis of a peptide deformylase inhibitor BB-3497.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26-S24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
