A2364812
3-[(3-Cholamidopropyl)dimethylammonio]-2-hydroxy-1-propanesulfonate , 99% , 82473-24-3
Synonym(s):
3-([3-Cholamidopropyl]dimethylammonio)-2-hydroxy-1-propanesulfonate;3-[(3-Cholamidopropyl)dimethylammonio]-2-hydroxy-1-propanesulfonate;CHAPSO - CAS 82473-24-3 - Calbiochem
CAS NO.:82473-24-3
Empirical Formula: C32H58N2O8S
Molecular Weight: 630.88
MDL number: MFCD00081079
EINECS: 617-338-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB346.40 | In Stock |
|
| 5G | RMB1386.40 | In Stock |
|
| 25G | RMB4104.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-186 °C(lit.) |
| Density | 1.0453 (rough estimate) |
| refractive index | 1.6900 (estimate) |
| storage temp. | -20°C |
| solubility | H2O: 10 mg/mL at 20 °C, clear, colorless |
| form | White solid |
| color | White crystalline |
| Odor | Odorless |
| Water Solubility | 10 g/l at 20 °C |
| Merck | 13,2052 |
| BRN | 5842642 |
| InChIKey | GUQQBLRVXOUDTN-PPDWFABINA-N |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]3([H])C[C@H](O)[C@]4(C)[C@]([H])(CC[C@@]4([H])[C@]3([H])[C@H](O)C2)[C@H](C)CCC(=O)NCCC[N+](C)(C)CC(O)CS([O-])(=O)=O |
| CAS DataBase Reference | 82473-24-3(CAS DataBase Reference) |
Description and Uses
Chapso is a nondenaturing biological detergent with characteristics similar to CHAPS, although it is more soluble due to a more polar head group. Useful for the solubilization of integral membrane proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |

![3-[(3-Cholamidopropyl)dimethylammonio]-2-hydroxy-1-propanesulfonate](https://img.chemicalbook.com/CAS/GIF/82473-24-3.gif)


