A2365112
2-Chloro-6-(trifluoromethyl)pyridine , 98% , 39890-95-4
CAS NO.:39890-95-4
Empirical Formula: C6H3ClF3N
Molecular Weight: 181.54
MDL number: MFCD00042226
EINECS: 624-440-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 250MG | RMB23.20 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB198.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33 °C |
| Boiling point: | 60-62°C 8mm |
| Density | 1.416±0.06 g/cm3(Predicted) |
| Flash point: | 78°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Insoluble[in water] |
| Water Solubility | Insoluble in water |
| form | powder to lump |
| pka | -4.30±0.10(Predicted) |
| color | White to Almost white |
| FreezingPoint | 32.0 to 34.0 ℃ |
| BRN | 4308910 |
| InChI | InChI=1S/C6H3ClF3N/c7-5-3-1-2-4(11-5)6(8,9)10/h1-3H |
| InChIKey | ADVQMCQMDHBTHJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C(F)(F)F)=CC=C1 |
| CAS DataBase Reference | 39890-95-4(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-(trifluoromethyl)pyridine can be used in the synthesis of medicine, pesticide or biocidal product.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T;Xn,Xi,Xn,T |
| Risk Statements | 25-20/21/22-36/37/38-36 |
| Safety Statements | 26-36/37/39-45-36/37-9-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |





