PRODUCT Properties
| Melting point: | 178°C |
| Boiling point: | 314.2°C (rough estimate) |
| Density | 1.74 |
| vapor pressure | 1.0 x 10-5 Pa (25 °C) |
| refractive index | 1.6360 (estimate) |
| Flash point: | 2 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform: Slightly Soluble,Methanol: Slightly Soluble |
| form | Amorphous Powder |
| Water Solubility | 3.3 mg l-1 (25 °C) |
| pka | -2.68±0.20(Predicted) |
| color | White, beige |
| Merck | 14,1772 |
| BRN | 234872 |
| Exposure limits | ACGIH TLV: TWA 5 mg/m3. |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| Cosmetic Ingredient Review (CIR) | Captan (133-06-2) |
| InChI | 1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,5-6H,3-4H2 |
| InChIKey | LDVVMCZRFWMZSG-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)SN1C(=O)C2CC=CCC2C1=O |
| LogP | 2.57 at 25℃ |
| CAS DataBase Reference | 133-06-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Captan(133-06-2) |
| IARC | 3 (Vol. 30, Sup 7) 1987 |
| EPA Substance Registry System | Captan (133-06-2) |
Description and Uses
Captane is a pesticide belonging to the thiophtalimide group, mainly affecting agricultural workers. As a sensitizer and photosensitizer, it can induce contact urticaria. Its is used as a fungicide and a bacteriostatic agent in cosmetics and toiletries, particularily in shampoos. Cases of contact dermatitis were reoprted in painters, polishers and varnishers.
Fungicide; bacteriostat in soap.
Safety
| Symbol(GHS) |     GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H318-H331-H351-H400 |
| Precautionary statements | P201-P273-P280-P304+P340+P311-P305+P351+P338+P310-P308+P313 |
| Hazard Codes | T;N,N,T,Xn,F |
| Risk Statements | 23-40-41-43-50-36-20/21/22-11 |
| Safety Statements | 26-29-36/37/39-45-61-36/37-16 |
| RIDADR | UN 3077/9099 |
| OEB | B |
| OEL | TWA: 5 mg/m3 |
| WGK Germany | 2 |
| RTECS | GW5075000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Aquatic Acute 1 Carc. 2 Eye Dam. 1 Skin Sens. 1 |
| Hazardous Substances Data | 133-06-2(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 9000 mg/kg (Bridges) |
