A2374212
Chlortoluron solution , analyticalstandard,10ug/mlinpetroleumether , 15545-48-9
Synonym(s):
3-(3-Chloro-4-methyl)-1,1-dimethylurea
CAS NO.:15545-48-9
Empirical Formula: C10H13ClN2O
Molecular Weight: 212.68
MDL number: MFCD00018275
EINECS: 239-592-2
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148.3° |
| Boiling point: | 367.8±42.0 °C(Predicted) |
| Density | 1.2426 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform: slightly soluble; Methanol: slightly soluble |
| form | Solid |
| pka | 14.43±0.70(Predicted) |
| color | Off-white to light yellow |
| Water Solubility | 70.43mg/L(20 ºC) |
| Merck | 13,2191 |
| BRN | 2647688 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C10H13ClN2O/c1-7-4-5-8(6-9(7)11)12-10(14)13(2)3/h4-6H,1-3H3,(H,12,14) |
| InChIKey | JXCGFZXSOMJFOA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1ccc(C)c(Cl)c1 |
| CAS DataBase Reference | 15545-48-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Chlortoluron(15545-48-9) |
| EPA Substance Registry System | Chlorotoluron (15545-48-9) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H361d-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| Hazard Codes | Xn;N,N,Xn,F |
| Risk Statements | 40-50/53-63-36-20/21/22-11 |
| Safety Statements | 26-36/37-46-60-61-16 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | YS7230000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Repr. 2 |
| Hazardous Substances Data | 15545-48-9(Hazardous Substances Data) |
| Toxicity | rat,LC50,inhalation,1300mg/m3 (1300mg/m3),"Wirksubstanzen der Pflanzenschutz und Schadlingsbekampfungsmittel," Perkow, W., Berlin, Verlag Paul Parey, 1971-1976Vol. -, Pg. -, 1971/1976. |




