A2377412
4-Cyano-4'-ethylbiphenyl , 99% , 58743-75-2
CAS NO.：58743-75-2
Empirical Formula: C15H13N
Molecular Weight: 207.27
MDL number: MFCD00799420
EINECS: 261-414-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB146.40 | In Stock |
|
| 100G | RMB466.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76°C |
| Boiling point: | 202-205°C 3mm |
| Density | 1.07±0.1 g/cm3(Predicted) |
| Flash point: | 202-205°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| InChI | InChI=1S/C15H13N/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15/h3-10H,2H2,1H3 |
| InChIKey | DLLIPJSMDJCZRF-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CC)C=C2)=CC=C(C#N)C=C1 |
| CAS DataBase Reference | 58743-75-2(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-carbonitrile, 4'-ethyl- (58743-75-2) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H331-H335-H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21-36/37/38-41-20/21/22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3276 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
