A2383012
N-Cbz-D-aspartic Acid , 98% , 78663-07-7
Synonym(s):
Z-D -aspartic acid
CAS NO.:78663-07-7
Empirical Formula: C12H13NO6
Molecular Weight: 267.23
MDL number: MFCD00063182
EINECS: 679-598-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117 °C |
| Boiling point: | 472.8±45.0 °C(Predicted) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| refractive index | -10 ° (C=7, AcOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Methanol (Sparingly) |
| form | Solid |
| pka | 3.75±0.23(Predicted) |
| color | White to Off-White |
| optical activity | Consistent with structure |
| BRN | 2566464 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H13NO6/c14-10(15)6-9(11(16)17)13-12(18)19-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,18)(H,14,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | XYXYXSKSTZAEJW-SECBINFHSA-N |
| SMILES | OC(=O)C[C@@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 78663-07-7(CAS DataBase Reference) |
Description and Uses
A competitive inhibitor of indole-3-acetyl-L-aspartic acid hydrolase of Enterobacter agglomerans.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







