A2384712
N-Carbobenzoxy-O-tert-butyl-L-serine , 98% , 1676-75-1
Synonym(s):
N-Z-O-tert-butyl-L -serine
CAS NO.:1676-75-1
Empirical Formula: C15H21NO5
Molecular Weight: 295.33
MDL number: MFCD00038275
EINECS: 216-827-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB261.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148 °C |
| Boiling point: | 465.3±45.0 °C(Predicted) |
| Density | 1.174±0.06 g/cm3(Predicted) |
| refractive index | 20.5 ° (C=1, EtOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | almost transparency in EtOH |
| form | powder to crystal |
| pka | 3.54±0.10(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| BRN | 2000284 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO5/c1-15(2,3)21-10-12(13(17)18)16-14(19)20-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | TXDGEONUWGOCJG-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 1676-75-1(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







