A2387212
Cyanoacetohydrazide , 98% , 140-87-4
Synonym(s):
Cyanoacetic hydrazide
CAS NO.：140-87-4
Empirical Formula: C3H5N3O
Molecular Weight: 99.09
MDL number: MFCD00007611
EINECS: 205-437-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB66.40 | In Stock |
|
| 25G | RMB197.60 | In Stock |
|
| 100G | RMB475.20 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110 °C (lit.) |
| Boiling point: | 185.55°C (rough estimate) |
| Density | 1.3131 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO : 150 mg/mL (1513.78 mM) |
| form | powder to crystal |
| pka | pK1:2.34(+2);pK2:11.17(+1) (25°C) |
| color | White to Light yellow to Light orange |
| Water Solubility | almost transparency |
| Merck | 14,2680 |
| BRN | 1751498 |
| InChI | InChI=1S/C3H5N3O/c4-2-1-3(7)6-5/h1,5H2,(H,6,7) |
| InChIKey | HPHBOJANXDKUQD-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)CC#N |
| CAS DataBase Reference | 140-87-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Alpha-cyanoacetic acid, hydrazide(140-87-4) |
Description and Uses
2-Cyanoacetohydrazide is used in the study of the viral inhibiting activity of some potential antiviral agents.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AG4200000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29280090 |
| Hazardous Substances Data | 140-87-4(Hazardous Substances Data) |
| Toxicity | mouse,LD50,intraperitoneal,100mg/kg (100mg/kg),National Technical Information Service. Vol. AD277-689, |
