A2388712
5-Chloro-2-nitrobenzoic acid , 98% , 2516-95-2
CAS NO.:2516-95-2
Empirical Formula: C7H4ClNO4
Molecular Weight: 201.56
MDL number: MFCD00007290
EINECS: 219-738-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB243.20 | In Stock |
|
| 500G | RMB964.00 | In Stock |
|
| 1kg | RMB1255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-139 °C (lit.) |
| Boiling point: | 160.5°C (rough estimate) |
| Density | 1,608g/cm |
| refractive index | 1.6000 (estimate) |
| Flash point: | 100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 9.67g/l |
| form | Crystalline Powder |
| pka | 1.86±0.25(Predicted) |
| color | Light yellow to yellow-green |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 1963952 |
| InChI | 1S/C7H4ClNO4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | ZKUYSJHXBFFGPU-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(Cl)ccc1[N+]([O-])=O |
| CAS DataBase Reference | 2516-95-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-nitrobenzoic acid(2516-95-2) |
| EPA Substance Registry System | Benzoic acid, 5-chloro-2-nitro- (2516-95-2) |
Description and Uses
5-Chloro-2-nitrobenzoic acid was used as a component of 5,5′-dithiobis-2-nitrobenzoic acid, which found application to the determination of the acid-soluble disulphide content of the blood. Benzene and some of its derivatives (e.g. chloronitrobenzoic acids) have been shown to cause alterations in heme and globin synthesis. Chloronitrobenzoic acids inhibited the activity of δ-aminolevulinic acid (δ-ALA) and enhanced ferrochelatase (FC) activity. 5-Chloro-2-nitrobenzoic acid was also used as component of synthesis of 2-aryl 4(3H)-quinazolinones and 6-pyrrolidinyl-2-(2-substituted phenyl)-4-quinazolinones, which are potential anticancer candidates[1].
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50/53-41-37/38-22 |
| Safety Statements | 22-24/25-61-60-36/37/39-26-36 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





